Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Methyl 2,4,6-trihydroxybenzoate, 98%
CAS: 3147-39-5 Molecular Formula: C8H8O5 Molecular Weight (g/mol): 184.147 MDL Number: MFCD00013969 InChI Key: AQDIJIAUYXOCGX-UHFFFAOYSA-N PubChem CID: 76600 IUPAC Name: methyl 2,4,6-trihydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1O)O)O
| PubChem CID | 76600 |
|---|---|
| CAS | 3147-39-5 |
| Molecular Weight (g/mol) | 184.147 |
| MDL Number | MFCD00013969 |
| SMILES | COC(=O)C1=C(C=C(C=C1O)O)O |
| IUPAC Name | methyl 2,4,6-trihydroxybenzoate |
| InChI Key | AQDIJIAUYXOCGX-UHFFFAOYSA-N |
| Molecular Formula | C8H8O5 |
4-Ethoxybenzoic acid, 98+%
CAS: 619-86-3 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002545 InChI Key: SHSGDXCJYVZFTP-UHFFFAOYSA-N Synonym: p-ethoxybenzoic acid,benzoic acid, 4-ethoxy,benzoic acid, p-ethoxy,4-ethoxy-benzoic acid,unii-tzr23xeq7w,tzr23xeq7w,4-ethoxybenzoicacid,4ethoxybenzoic acid,pubchem2686,para-ethoxybenzoic acid PubChem CID: 12093 IUPAC Name: 4-ethoxybenzoic acid SMILES: CCOC1=CC=C(C=C1)C(=O)O
| PubChem CID | 12093 |
|---|---|
| CAS | 619-86-3 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00002545 |
| SMILES | CCOC1=CC=C(C=C1)C(=O)O |
| Synonym | p-ethoxybenzoic acid,benzoic acid, 4-ethoxy,benzoic acid, p-ethoxy,4-ethoxy-benzoic acid,unii-tzr23xeq7w,tzr23xeq7w,4-ethoxybenzoicacid,4ethoxybenzoic acid,pubchem2686,para-ethoxybenzoic acid |
| IUPAC Name | 4-ethoxybenzoic acid |
| InChI Key | SHSGDXCJYVZFTP-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
4-Bromo-3-methylanisole, 97%
CAS: 27060-75-9 Molecular Formula: C8H9BrO Molecular Weight (g/mol): 201.063 MDL Number: MFCD00060687 InChI Key: BLZNSXFQRKVFRP-UHFFFAOYSA-N Synonym: 2-bromo-5-methoxytoluene,4-bromo-3-methylanisole,benzene, 1-bromo-4-methoxy-2-methyl,4-bromo-3-methyl-anisole,unii-okr329132j,1-bromo-2-methyl-4-methoxybenzene,1-brom-4-methoxy-2-methylbenzol,pubchem3796,3-methyl-4-bromoanisole,acmc-1cg4z PubChem CID: 117915 IUPAC Name: 1-bromo-4-methoxy-2-methylbenzene SMILES: CC1=C(C=CC(=C1)OC)Br
| PubChem CID | 117915 |
|---|---|
| CAS | 27060-75-9 |
| Molecular Weight (g/mol) | 201.063 |
| MDL Number | MFCD00060687 |
| SMILES | CC1=C(C=CC(=C1)OC)Br |
| Synonym | 2-bromo-5-methoxytoluene,4-bromo-3-methylanisole,benzene, 1-bromo-4-methoxy-2-methyl,4-bromo-3-methyl-anisole,unii-okr329132j,1-bromo-2-methyl-4-methoxybenzene,1-brom-4-methoxy-2-methylbenzol,pubchem3796,3-methyl-4-bromoanisole,acmc-1cg4z |
| IUPAC Name | 1-bromo-4-methoxy-2-methylbenzene |
| InChI Key | BLZNSXFQRKVFRP-UHFFFAOYSA-N |
| Molecular Formula | C8H9BrO |
3-Methylcatechol, 97%
CAS: 488-17-5 Molecular Formula: C7H8O2 Molecular Weight (g/mol): 124.139 MDL Number: MFCD00016435 InChI Key: PGSWEKYNAOWQDF-UHFFFAOYSA-N Synonym: 3-methylcatechol,2,3-dihydroxytoluene,3-methylpyrocatechol,1,2-benzenediol, 3-methyl,2,3-toluenediol,dihydroxytoluene,pyrocatechol, 3-methyl,catechol, 3-methyl,1,2-dihydroxy-3-methylbenzene,3-methyl-1,2-benzenediol PubChem CID: 340 ChEBI: CHEBI:18404 IUPAC Name: 3-methylbenzene-1,2-diol SMILES: CC1=C(C(=CC=C1)O)O
| PubChem CID | 340 |
|---|---|
| CAS | 488-17-5 |
| Molecular Weight (g/mol) | 124.139 |
| ChEBI | CHEBI:18404 |
| MDL Number | MFCD00016435 |
| SMILES | CC1=C(C(=CC=C1)O)O |
| Synonym | 3-methylcatechol,2,3-dihydroxytoluene,3-methylpyrocatechol,1,2-benzenediol, 3-methyl,2,3-toluenediol,dihydroxytoluene,pyrocatechol, 3-methyl,catechol, 3-methyl,1,2-dihydroxy-3-methylbenzene,3-methyl-1,2-benzenediol |
| IUPAC Name | 3-methylbenzene-1,2-diol |
| InChI Key | PGSWEKYNAOWQDF-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2 |
Benzo[b]thiophene, 98+%
CAS: 95-15-8 Molecular Formula: C8H6S Molecular Weight (g/mol): 134.196 MDL Number: MFCD00005864 InChI Key: FCEHBMOGCRZNNI-UHFFFAOYSA-N Synonym: benzo b thiophene,thianaphthene,benzothiophene,benzothiofuran,thionaphthene,1-thiaindene,thianaphthen,benzothiophen,thianaphtene,1-benzothiophen PubChem CID: 7221 ChEBI: CHEBI:35858 IUPAC Name: 1-benzothiophene SMILES: C1=CC=C2C(=C1)C=CS2
| PubChem CID | 7221 |
|---|---|
| CAS | 95-15-8 |
| Molecular Weight (g/mol) | 134.196 |
| ChEBI | CHEBI:35858 |
| MDL Number | MFCD00005864 |
| SMILES | C1=CC=C2C(=C1)C=CS2 |
| Synonym | benzo b thiophene,thianaphthene,benzothiophene,benzothiofuran,thionaphthene,1-thiaindene,thianaphthen,benzothiophen,thianaphtene,1-benzothiophen |
| IUPAC Name | 1-benzothiophene |
| InChI Key | FCEHBMOGCRZNNI-UHFFFAOYSA-N |
| Molecular Formula | C8H6S |
2,5-Dimethylpyrazine, 99%
CAS: 123-32-0 Molecular Formula: C6H8N2 Molecular Weight (g/mol): 108.144 MDL Number: MFCD00006147 InChI Key: LCZUOKDVTBMCMX-UHFFFAOYSA-N Synonym: 2,5-dimethyl pyrazine,pyrazine, 2,5-dimethyl,2,5-dimethylpiazine,2,5-dimethyl-1,4-diazine,2,5-dimethylparadiazine,2,5-dimethyl-pyrazine,unii-v99y0muy1q,fema no. 3272,ccris 2929,natural PubChem CID: 31252 IUPAC Name: 2,5-dimethylpyrazine SMILES: CC1=CN=C(C=N1)C
| PubChem CID | 31252 |
|---|---|
| CAS | 123-32-0 |
| Molecular Weight (g/mol) | 108.144 |
| MDL Number | MFCD00006147 |
| SMILES | CC1=CN=C(C=N1)C |
| Synonym | 2,5-dimethyl pyrazine,pyrazine, 2,5-dimethyl,2,5-dimethylpiazine,2,5-dimethyl-1,4-diazine,2,5-dimethylparadiazine,2,5-dimethyl-pyrazine,unii-v99y0muy1q,fema no. 3272,ccris 2929,natural |
| IUPAC Name | 2,5-dimethylpyrazine |
| InChI Key | LCZUOKDVTBMCMX-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2 |
1,10-Dibromodecane, 97%
CAS: 4101-68-2 Molecular Formula: C10H20Br2 Molecular Weight (g/mol): 300.08 MDL Number: MFCD00000222 InChI Key: GTQHJCOHNAFHRE-UHFFFAOYSA-N Synonym: decamethylene dibromide,decane, 1,10-dibromo,1,10-dibromodecan,1,10-dibromo-decan,1,10-decamethylene bromide,1,10-decamethylene dibromide,a,w-dibromodecane,1,10-dibromdecane,1,10 dibromodecane,decane,10-dibromo PubChem CID: 221483 IUPAC Name: 1,10-dibromodecane SMILES: BrCCCCCCCCCCBr
| PubChem CID | 221483 |
|---|---|
| CAS | 4101-68-2 |
| Molecular Weight (g/mol) | 300.08 |
| MDL Number | MFCD00000222 |
| SMILES | BrCCCCCCCCCCBr |
| Synonym | decamethylene dibromide,decane, 1,10-dibromo,1,10-dibromodecan,1,10-dibromo-decan,1,10-decamethylene bromide,1,10-decamethylene dibromide,a,w-dibromodecane,1,10-dibromdecane,1,10 dibromodecane,decane,10-dibromo |
| IUPAC Name | 1,10-dibromodecane |
| InChI Key | GTQHJCOHNAFHRE-UHFFFAOYSA-N |
| Molecular Formula | C10H20Br2 |
Ethyl (ethoxymethylene)cyanoacetate, 98%
CAS: 94-05-3 Molecular Formula: C8H11NO3 Molecular Weight (g/mol): 169.18 MDL Number: MFCD00009136 InChI Key: KTMGNAIGXYODKQ-SREVYHEPSA-N Synonym: ethyl ethoxymethylene cyanoacetate,e-ethyl 2-cyano-3-ethoxyacrylate,ethyl 2-cyano-3-ethoxyacrylate,ethyl 3-ethoxy-2-cyanoacrylate,ethyl 2e-2-cyano-3-ethoxyprop-2-enoate,ethyl cyano ethoxymethylene acetate,2-propenoic acid, 2-cyano-3-ethoxy-, ethyl ester,2-cyano-3-ethoxy-2-propenoic acid ethyl ester,2-cyano-3-ethoxyacrylic acid ethyl ester,ethyl 2e-2-cyano-3-ethoxy-2-propenoate PubChem CID: 1715183 IUPAC Name: ethyl (E)-2-cyano-3-ethoxyprop-2-enoate SMILES: CCO\C=C(\C#N)C(=O)OCC
| PubChem CID | 1715183 |
|---|---|
| CAS | 94-05-3 |
| Molecular Weight (g/mol) | 169.18 |
| MDL Number | MFCD00009136 |
| SMILES | CCO\C=C(\C#N)C(=O)OCC |
| Synonym | ethyl ethoxymethylene cyanoacetate,e-ethyl 2-cyano-3-ethoxyacrylate,ethyl 2-cyano-3-ethoxyacrylate,ethyl 3-ethoxy-2-cyanoacrylate,ethyl 2e-2-cyano-3-ethoxyprop-2-enoate,ethyl cyano ethoxymethylene acetate,2-propenoic acid, 2-cyano-3-ethoxy-, ethyl ester,2-cyano-3-ethoxy-2-propenoic acid ethyl ester,2-cyano-3-ethoxyacrylic acid ethyl ester,ethyl 2e-2-cyano-3-ethoxy-2-propenoate |
| IUPAC Name | ethyl (E)-2-cyano-3-ethoxyprop-2-enoate |
| InChI Key | KTMGNAIGXYODKQ-SREVYHEPSA-N |
| Molecular Formula | C8H11NO3 |
2,4-Dichlorobenzoic acid, 98%
CAS: 50-84-0 Molecular Formula: C7H4Cl2O2 Molecular Weight (g/mol): 191.007 MDL Number: MFCD00002414 InChI Key: ATCRIUVQKHMXSH-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dichloro,2,4-dichlorobenzoesyre,2,4 dichlorobenzoic acid,2,4-dichloro-benzoic acid,2,4-dichlorobenzoicacid,ccris 9472,furosemide impurity e,pubchem21313,acmc-209kqh,wln: qvr bg dg PubChem CID: 5787 ChEBI: CHEBI:30748 IUPAC Name: 2,4-dichlorobenzoic acid SMILES: C1=CC(=C(C=C1Cl)Cl)C(=O)O
| PubChem CID | 5787 |
|---|---|
| CAS | 50-84-0 |
| Molecular Weight (g/mol) | 191.007 |
| ChEBI | CHEBI:30748 |
| MDL Number | MFCD00002414 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)O |
| Synonym | benzoic acid, 2,4-dichloro,2,4-dichlorobenzoesyre,2,4 dichlorobenzoic acid,2,4-dichloro-benzoic acid,2,4-dichlorobenzoicacid,ccris 9472,furosemide impurity e,pubchem21313,acmc-209kqh,wln: qvr bg dg |
| IUPAC Name | 2,4-dichlorobenzoic acid |
| InChI Key | ATCRIUVQKHMXSH-UHFFFAOYSA-N |
| Molecular Formula | C7H4Cl2O2 |
Cyclopentanecarboxylic acid, 99%
CAS: 3400-45-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.144 MDL Number: MFCD00001371 InChI Key: JBDSSBMEKXHSJF-UHFFFAOYSA-N Synonym: cyclopentane carboxylic acid,cyclopentylcarboxylic acid,cyclopentancarboxylic acid,cyclopentanoic acid,unii-z6691vh94a,cyclopentylmethanoic acid,pubchem14153,carboxycyclopentane,cyclopentyl carboxylic acid,acmc-209i4g PubChem CID: 18840 IUPAC Name: cyclopentanecarboxylic acid SMILES: C1CCC(C1)C(=O)O
| PubChem CID | 18840 |
|---|---|
| CAS | 3400-45-1 |
| Molecular Weight (g/mol) | 114.144 |
| MDL Number | MFCD00001371 |
| SMILES | C1CCC(C1)C(=O)O |
| Synonym | cyclopentane carboxylic acid,cyclopentylcarboxylic acid,cyclopentancarboxylic acid,cyclopentanoic acid,unii-z6691vh94a,cyclopentylmethanoic acid,pubchem14153,carboxycyclopentane,cyclopentyl carboxylic acid,acmc-209i4g |
| IUPAC Name | cyclopentanecarboxylic acid |
| InChI Key | JBDSSBMEKXHSJF-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
Sodium chloroacetate, 98%
CAS: 3926-62-3 Molecular Formula: C2H2ClNaO2 Molecular Weight (g/mol): 116.476 MDL Number: MFCD00002684 InChI Key: FDRCDNZGSXJAFP-UHFFFAOYSA-M Synonym: sodium chloroacetate,chloroacetic acid sodium salt,monoxone,acetic acid, chloro-, sodium salt,dow defoliant,sodium monochloroacetate,smca,sodium monochloracetate,caswell no. 755a,chloroctan sodny czech PubChem CID: 23665759 IUPAC Name: sodium;2-chloroacetate SMILES: C(C(=O)[O-])Cl.[Na+]
| PubChem CID | 23665759 |
|---|---|
| CAS | 3926-62-3 |
| Molecular Weight (g/mol) | 116.476 |
| MDL Number | MFCD00002684 |
| SMILES | C(C(=O)[O-])Cl.[Na+] |
| Synonym | sodium chloroacetate,chloroacetic acid sodium salt,monoxone,acetic acid, chloro-, sodium salt,dow defoliant,sodium monochloroacetate,smca,sodium monochloracetate,caswell no. 755a,chloroctan sodny czech |
| IUPAC Name | sodium;2-chloroacetate |
| InChI Key | FDRCDNZGSXJAFP-UHFFFAOYSA-M |
| Molecular Formula | C2H2ClNaO2 |
2,4-Dichlorothiophenol, 97%
CAS: 1122-41-4 Molecular Formula: C6H4Cl2S Molecular Weight (g/mol): 179.058 MDL Number: MFCD00041421 InChI Key: FGBVJFREPSJSNG-UHFFFAOYSA-N Synonym: 2,4-dichlorothiophenol,2,4-dichlorobenzene-1-thiol,benzenethiol, 2,4-dichloro,2,4-dichloro thiophenol,pubchem6798,2,4 dichlorothiophenol,acmc-1buvb,2,4-dichlorothio-phenol,2,4-dichloro-benzenethiol,# PubChem CID: 70730 IUPAC Name: 2,4-dichlorobenzenethiol SMILES: C1=CC(=C(C=C1Cl)Cl)S
| PubChem CID | 70730 |
|---|---|
| CAS | 1122-41-4 |
| Molecular Weight (g/mol) | 179.058 |
| MDL Number | MFCD00041421 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)S |
| Synonym | 2,4-dichlorothiophenol,2,4-dichlorobenzene-1-thiol,benzenethiol, 2,4-dichloro,2,4-dichloro thiophenol,pubchem6798,2,4 dichlorothiophenol,acmc-1buvb,2,4-dichlorothio-phenol,2,4-dichloro-benzenethiol,# |
| IUPAC Name | 2,4-dichlorobenzenethiol |
| InChI Key | FGBVJFREPSJSNG-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2S |
(S)-(-)-Nicotine, 98+%
CAS: 54-11-5 Molecular Formula: C10H14N2 MDL Number: MFCD00006369 InChI Key: SNICXCGAKADSCV-JTQLQIEISA-N Synonym: nicotine,l-nicotine,--nicotine,s-nicotine,habitrol,s-3-1-methylpyrrolidin-2-yl pyridine,nicoderm,nicotrol,s---nicotine,nicoderm cq PubChem CID: 89594 ChEBI: CHEBI:17688 IUPAC Name: 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine
| PubChem CID | 89594 |
|---|---|
| CAS | 54-11-5 |
| ChEBI | CHEBI:17688 |
| MDL Number | MFCD00006369 |
| Synonym | nicotine,l-nicotine,--nicotine,s-nicotine,habitrol,s-3-1-methylpyrrolidin-2-yl pyridine,nicoderm,nicotrol,s---nicotine,nicoderm cq |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChI Key | SNICXCGAKADSCV-JTQLQIEISA-N |
| Molecular Formula | C10H14N2 |
Trimethyl 4-phosphonocrotonate, (E)+(Z), 90+%
CAS: 86120-40-3 Molecular Formula: C7H13O5P Molecular Weight (g/mol): 208.15 MDL Number: MFCD00051564 InChI Key: PESRINKNQQZURC-SNAWJCMRSA-N Synonym: methyl 4-dimethoxyphosphoryl but-2-enoate,trimethyl 4-phosphonocrotonate,methyl 2e-4-dimethoxyphosphoryl but-2-enoate,methyl 4-dimethoxyphosphorylbut-2-enoate,trimethyl 4-phosphonocrotonate, e + z,methyl e-4-dimethoxyphosphorylbut-2-enoate,4-dimethoxyphosphinyl crotonic acid methyl ester,e-4-dimethoxy-phosphoryl-but-2-enoic acid methyl ester PubChem CID: 5702556 IUPAC Name: methyl (E)-4-dimethoxyphosphorylbut-2-enoate SMILES: COC(=O)\C=C\CP(=O)(OC)OC
| PubChem CID | 5702556 |
|---|---|
| CAS | 86120-40-3 |
| Molecular Weight (g/mol) | 208.15 |
| MDL Number | MFCD00051564 |
| SMILES | COC(=O)\C=C\CP(=O)(OC)OC |
| Synonym | methyl 4-dimethoxyphosphoryl but-2-enoate,trimethyl 4-phosphonocrotonate,methyl 2e-4-dimethoxyphosphoryl but-2-enoate,methyl 4-dimethoxyphosphorylbut-2-enoate,trimethyl 4-phosphonocrotonate, e + z,methyl e-4-dimethoxyphosphorylbut-2-enoate,4-dimethoxyphosphinyl crotonic acid methyl ester,e-4-dimethoxy-phosphoryl-but-2-enoic acid methyl ester |
| IUPAC Name | methyl (E)-4-dimethoxyphosphorylbut-2-enoate |
| InChI Key | PESRINKNQQZURC-SNAWJCMRSA-N |
| Molecular Formula | C7H13O5P |
S-Methyl thioacetate, 98+%
CAS: 1534-08-3 Molecular Formula: C3H6OS Molecular Weight (g/mol): 90.14 MDL Number: MFCD00014989 InChI Key: OATSQCXMYKYFQO-UHFFFAOYSA-N Synonym: s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester PubChem CID: 73750 ChEBI: CHEBI:51280 IUPAC Name: S-methyl ethanethioate SMILES: CC(=O)SC
| PubChem CID | 73750 |
|---|---|
| CAS | 1534-08-3 |
| Molecular Weight (g/mol) | 90.14 |
| ChEBI | CHEBI:51280 |
| MDL Number | MFCD00014989 |
| SMILES | CC(=O)SC |
| Synonym | s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester |
| IUPAC Name | S-methyl ethanethioate |
| InChI Key | OATSQCXMYKYFQO-UHFFFAOYSA-N |
| Molecular Formula | C3H6OS |